C22H24N4O5S — CID 15944869
1-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(2-methylphenyl)pyrrolidine-2-carboxamide (PubChem CID 15944869) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(2-methylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(2-methylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 15944869 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonyl-N-(2-methylphenyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1CCCN1S(=O)(=O)c1ccc2c(c1)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C22H24N4O5S/c1-14-7-4-5-8-16(14)23-20(27)18-9-6-12-26(18)32(30,31)15-10-11-17-19(13-15)25(3)22(29)21(28)24(17)2/h4-5,7-8,10-11,13,18H,6,9,12H2,1-3H3,(H,23,27) |
| InChIKey | ZATLNUVJIJNASP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|