About N,N-dimethylpyridin-4-amine;triethylborane
N,N-dimethylpyridin-4-amine;triethylborane (PubChem CID 159448886) has the molecular formula C13H25BN2
and a molecular weight of 220.17 g/mol. Its IUPAC name is N,N-dimethylpyridin-4-amine;triethylborane.
Molecular Properties
| Compound Name | N,N-dimethylpyridin-4-amine;triethylborane |
| PubChem CID | 159448886 |
| Molecular Formula | C13H25BN2 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | N,N-dimethylpyridin-4-amine;triethylborane |
| SMILES | CCB(CC)CC.CN(C)c1ccncc1 |
| InChI | InChI=1S/C7H10N2.C6H15B/c1-9(2)7-3-5-8-6-4-7;1-4-7(5-2)6-3/h3-6H,1-2H3;4-6H2,1-3H3 |
| InChIKey | LTCKKKFWTFMNCD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylpyridin-4-amine;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpyridin-4-amine;triethylborane?
The IUPAC name of N,N-dimethylpyridin-4-amine;triethylborane (CID 159448886) is N,N-dimethylpyridin-4-amine;triethylborane.
What is the SMILES notation for N,N-dimethylpyridin-4-amine;triethylborane?
The canonical SMILES for N,N-dimethylpyridin-4-amine;triethylborane is CCB(CC)CC.CN(C)c1ccncc1.
What is the InChIKey of N,N-dimethylpyridin-4-amine;triethylborane?
The InChIKey is LTCKKKFWTFMNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H15B/c1-9(2)7-3-5-8-6-4-7;1-4-7(5-2)6-3/h3-6H,1-2H3;4-6H2,1-3H3.
What are the key properties of N,N-dimethylpyridin-4-amine;triethylborane?
N,N-dimethylpyridin-4-amine;triethylborane has a molecular weight of 220.17 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyridin-4-amine;triethylborane is sourced from PubChem (CID 159448886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).