C14H13NO2 — CID 159448998
1-isoquinolin-6-ylpentane-2,4-dione (PubChem CID 159448998) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-isoquinolin-6-ylpentane-2,4-dione.
| Compound Name | 1-isoquinolin-6-ylpentane-2,4-dione |
|---|---|
| PubChem CID | 159448998 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1-isoquinolin-6-ylpentane-2,4-dione |
| SMILES | CC(=O)CC(=O)Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C14H13NO2/c1-10(16)6-14(17)8-11-2-3-13-9-15-5-4-12(13)7-11/h2-5,7,9H,6,8H2,1H3 |
| InChIKey | LTCTXJYXNYXHIR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|