C33H22BN3S — CID 159449158
CID 159449158 (PubChem CID 159449158) has the molecular formula C33H22BN3S and a molecular weight of 503.44 g/mol.
| Compound Name | CID 159449158 |
|---|---|
| PubChem CID | 159449158 |
| Molecular Formula | C33H22BN3S |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | — |
| SMILES | [B]C(=C)c1sc2c(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cccc2c1C=C |
| InChI | InChI=1S/C33H22BN3S/c1-3-26-28-19-11-18-27(30(28)38-29(26)21(2)34)24-16-10-17-25(20-24)33-36-31(22-12-6-4-7-13-22)35-32(37-33)23-14-8-5-9-15-23/h3-20H,1-2H2 |
| InChIKey | KJCQKTVIECNDDF-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|