C28H16BrNOS — CID 15944971
phenyl(11-thia-4-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)methanone bromide (PubChem CID 15944971) has the molecular formula C28H16BrNOS and a molecular weight of 494.41 g/mol. Its IUPAC name is phenyl(11-thia-4-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)methanone bromide.
| Compound Name | phenyl(11-thia-4-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)methanone bromide |
|---|---|
| PubChem CID | 15944971 |
| Molecular Formula | C28H16BrNOS |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | phenyl(11-thia-4-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,4(12),5,7,9,13,15,17,19(23),20-undecaen-3-yl)methanone bromide |
| SMILES | O=C(c1ccccc1)c1c2c(cc3sc4ccccc4[n+]13)-c1cccc3cccc-2c13.[Br-] |
| InChI | InChI=1S/C28H16NOS.BrH/c30-28(18-8-2-1-3-9-18)27-26-20-13-7-11-17-10-6-12-19(25(17)20)21(26)16-24-29(27)22-14-4-5-15-23(22)31-24;/h1-16H;1H/q+1;/p-1 |
| InChIKey | HJFAOSUMJYNIBB-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 21.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|