About osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine)
osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) (PubChem CID 159449942) has the molecular formula C44H32N4Os+2
and a molecular weight of 807.00 g/mol. Its IUPAC name is osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine).
Molecular Properties
| Compound Name | osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) |
| PubChem CID | 159449942 |
| Molecular Formula | C44H32N4Os+2 |
| Molecular Weight | 807.00 g/mol |
| Exact Mass | 808.22 |
| IUPAC Name | osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) |
| SMILES | [Os+2].c1ccc(-c2ccnc(-c3cc(-c4ccccc4)ccn3)c2)cc1.c1ccc(-c2ccnc(-c3cc(-c4ccccc4)ccn3)c2)cc1 |
| InChI | InChI=1S/2C22H16N2.Os/c2*1-3-7-17(8-4-1)19-11-13-23-21(15-19)22-16-20(12-14-24-22)18-9-5-2-6-10-18;/h2*1-16H;/q;;+2 |
| InChIKey | LTFYXCXMCSWOBE-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 807.00 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine)?
The IUPAC name of osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) (CID 159449942) is osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine).
What is the SMILES notation for osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine)?
The canonical SMILES for osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) is [Os+2].c1ccc(-c2ccnc(-c3cc(-c4ccccc4)ccn3)c2)cc1.c1ccc(-c2ccnc(-c3cc(-c4ccccc4)ccn3)c2)cc1.
What is the InChIKey of osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine)?
The InChIKey is LTFYXCXMCSWOBE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C22H16N2.Os/c2*1-3-7-17(8-4-1)19-11-13-23-21(15-19)22-16-20(12-14-24-22)18-9-5-2-6-10-18;/h2*1-16H;/q;;+2.
What are the key properties of osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine)?
osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) has a molecular weight of 807.00 g/mol, XLogP of 10.95, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for osmium(2+);bis(4-phenyl-2-(4-phenyl-2-pyridinyl)pyridine) is sourced from PubChem (CID 159449942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).