About 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone
2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone (PubChem CID 15945084) has the molecular formula C23H24N2O4S
and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone.
Molecular Properties
| Compound Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone |
| PubChem CID | 15945084 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone |
| SMILES | CCOc1cc(/C=C/c2nc3ccccc3s2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H24N2O4S/c1-2-28-20-15-17(8-10-22-24-18-5-3-4-6-21(18)30-22)7-9-19(20)29-16-23(26)25-11-13-27-14-12-25/h3-10,15H,2,11-14,16H2,1H3/b10-8+ |
| InChIKey | XQKSVQJRTYCIKN-CSKARUKUSA-N |
| XLogP | 4.10 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone?
The IUPAC name of 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone (CID 15945084) is 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone.
What is the SMILES notation for 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone?
The canonical SMILES for 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone is CCOc1cc(/C=C/c2nc3ccccc3s2)ccc1OCC(=O)N1CCOCC1.
What is the InChIKey of 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone?
The InChIKey is XQKSVQJRTYCIKN-CSKARUKUSA-N. The full InChI is InChI=1S/C23H24N2O4S/c1-2-28-20-15-17(8-10-22-24-18-5-3-4-6-21(18)30-22)7-9-19(20)29-16-23(26)25-11-13-27-14-12-25/h3-10,15H,2,11-14,16H2,1H3/b10-8+.
What are the key properties of 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone?
2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone has a molecular weight of 424.52 g/mol, XLogP of 4.10, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-ethoxyphenoxy]-1-morpholin-4-ylethanone is sourced from PubChem (CID 15945084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).