About 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline
2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline (PubChem CID 159451197) has the molecular formula C28H27F6N3O
and a molecular weight of 535.53 g/mol. Its IUPAC name is 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline.
Molecular Properties
| Compound Name | 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline |
| PubChem CID | 159451197 |
| Molecular Formula | C28H27F6N3O |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline |
| SMILES | COc1ccc(N)cc1.Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1.Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H13N.C8H5F6N.C7H9NO/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4;1-9-7-4-2-6(8)3-5-7/h1-9H,10,14H2;1-3H,15H2;2-5H,8H2,1H3 |
| InChIKey | LTJZXKIALCTWED-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline?
The IUPAC name of 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline (CID 159451197) is 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline.
What is the SMILES notation for 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline?
The canonical SMILES for 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline is COc1ccc(N)cc1.Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1.Nc1ccccc1Cc1ccccc1.
What is the InChIKey of 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline?
The InChIKey is LTJZXKIALCTWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C8H5F6N.C7H9NO/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11;9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4;1-9-7-4-2-6(8)3-5-7/h1-9H,10,14H2;1-3H,15H2;2-5H,8H2,1H3.
What are the key properties of 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline?
2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline has a molecular weight of 535.53 g/mol, XLogP of 7.44, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylaniline;3,5-bis(trifluoromethyl)aniline;4-methoxyaniline is sourced from PubChem (CID 159451197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).