C21H28N4O3S3 — CID 15945129
N-(1,1-dioxothiolan-3-yl)-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 15945129) has the molecular formula C21H28N4O3S3 and a molecular weight of 480.68 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 15945129 |
| Molecular Formula | C21H28N4O3S3 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[[5-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC2CCS(=O)(=O)C2)nnc1-c1cc2c(s1)CCC(CC)C2 |
| InChI | InChI=1S/C21H28N4O3S3/c1-3-8-25-20(18-11-15-10-14(4-2)5-6-17(15)30-18)23-24-21(25)29-12-19(26)22-16-7-9-31(27,28)13-16/h3,11,14,16H,1,4-10,12-13H2,2H3,(H,22,26) |
| InChIKey | AYZGWEKAEBRZTO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|