About 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride
4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride (PubChem CID 15945174) has the molecular formula C21H23Cl3N2S
and a molecular weight of 441.86 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride |
| PubChem CID | 15945174 |
| Molecular Formula | C21H23Cl3N2S |
| Molecular Weight | 441.86 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride |
| SMILES | CCCCCC[n+]1c(-c2ccc(Cl)cc2Cl)csc1Nc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H22Cl2N2S.ClH/c1-2-3-4-8-13-25-20(18-12-11-16(22)14-19(18)23)15-26-21(25)24-17-9-6-5-7-10-17;/h5-7,9-12,14-15H,2-4,8,13H2,1H3;1H |
| InChIKey | LIOWZZUXBXTZFZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride?
The IUPAC name of 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride (CID 15945174) is 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride?
The canonical SMILES for 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride is CCCCCC[n+]1c(-c2ccc(Cl)cc2Cl)csc1Nc1ccccc1.[Cl-].
What is the InChIKey of 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride?
The InChIKey is LIOWZZUXBXTZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22Cl2N2S.ClH/c1-2-3-4-8-13-25-20(18-12-11-16(22)14-19(18)23)15-26-21(25)24-17-9-6-5-7-10-17;/h5-7,9-12,14-15H,2-4,8,13H2,1H3;1H.
What are the key properties of 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride?
4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride has a molecular weight of 441.86 g/mol, XLogP of 4.34, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-3-hexyl-N-phenyl-1,3-thiazol-3-ium-2-amine chloride is sourced from PubChem (CID 15945174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).