C21H25FN2O5 — CID 15945235
N-(2-ethyl-6-methylphenyl)-2-[(2-fluorophenyl)methyl-methylamino]acetamide;oxalic acid (PubChem CID 15945235) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-[(2-fluorophenyl)methyl-methylamino]acetamide;oxalic acid.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-[(2-fluorophenyl)methyl-methylamino]acetamide;oxalic acid |
|---|---|
| PubChem CID | 15945235 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-[(2-fluorophenyl)methyl-methylamino]acetamide;oxalic acid |
| SMILES | CCc1cccc(C)c1NC(=O)CN(C)Cc1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23FN2O.C2H2O4/c1-4-15-10-7-8-14(2)19(15)21-18(23)13-22(3)12-16-9-5-6-11-17(16)20;3-1(4)2(5)6/h5-11H,4,12-13H2,1-3H3,(H,21,23);(H,3,4)(H,5,6) |
| InChIKey | CRVUMSLKCJSNIK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|