About 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide
5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide (PubChem CID 15945262) has the molecular formula C18H33IN2
and a molecular weight of 404.38 g/mol. Its IUPAC name is 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide.
Molecular Properties
| Compound Name | 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide |
| PubChem CID | 15945262 |
| Molecular Formula | C18H33IN2 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide |
| SMILES | CCCN(CCC)C1=CC(=[N+]2CCCC2)CC(C)(C)C1.[I-] |
| InChI | InChI=1S/C18H33N2.HI/c1-5-9-19(10-6-2)16-13-17(15-18(3,4)14-16)20-11-7-8-12-20;/h13H,5-12,14-15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SSILXPYPNCSULO-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
The IUPAC name of 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide (CID 15945262) is 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide.
What is the SMILES notation for 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
The canonical SMILES for 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide is CCCN(CCC)C1=CC(=[N+]2CCCC2)CC(C)(C)C1.[I-].
What is the InChIKey of 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
The InChIKey is SSILXPYPNCSULO-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H33N2.HI/c1-5-9-19(10-6-2)16-13-17(15-18(3,4)14-16)20-11-7-8-12-20;/h13H,5-12,14-15H2,1-4H3;1H/q+1;/p-1.
What are the key properties of 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide has a molecular weight of 404.38 g/mol, XLogP of 1.06, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-N,N-dipropyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide is sourced from PubChem (CID 15945262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).