About 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one
5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one (PubChem CID 159453221) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one |
| PubChem CID | 159453221 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one |
| SMILES | Cc1ccn2c(C(=O)CCc3ccc4c(c3)CC(=O)O4)c(C)nc2c1 |
| InChI | InChI=1S/C20H18N2O3/c1-12-7-8-22-18(9-12)21-13(2)20(22)16(23)5-3-14-4-6-17-15(10-14)11-19(24)25-17/h4,6-10H,3,5,11H2,1-2H3 |
| InChIKey | LTQJFVLZZLIDOC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one?
The IUPAC name of 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one (CID 159453221) is 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one.
What is the SMILES notation for 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one?
The canonical SMILES for 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one is Cc1ccn2c(C(=O)CCc3ccc4c(c3)CC(=O)O4)c(C)nc2c1.
What is the InChIKey of 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one?
The InChIKey is LTQJFVLZZLIDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-12-7-8-22-18(9-12)21-13(2)20(22)16(23)5-3-14-4-6-17-15(10-14)11-19(24)25-17/h4,6-10H,3,5,11H2,1-2H3.
What are the key properties of 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one?
5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one has a molecular weight of 334.38 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)-3-oxopropyl]-3H-1-benzofuran-2-one is sourced from PubChem (CID 159453221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).