C18H20IN3O2 — CID 15945329
5,7-dimethyl-8-(4-propan-2-ylphenyl)-1H-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione iodide (PubChem CID 15945329) has the molecular formula C18H20IN3O2 and a molecular weight of 437.28 g/mol. Its IUPAC name is 5,7-dimethyl-8-(4-propan-2-ylphenyl)-1H-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione iodide.
| Compound Name | 5,7-dimethyl-8-(4-propan-2-ylphenyl)-1H-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione iodide |
|---|---|
| PubChem CID | 15945329 |
| Molecular Formula | C18H20IN3O2 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 5,7-dimethyl-8-(4-propan-2-ylphenyl)-1H-pyrido[2,3-d]pyrimidin-8-ium-2,4-dione iodide |
| SMILES | Cc1cc(C)[n+](-c2ccc(C(C)C)cc2)c2[nH]c(=O)[nH]c(=O)c12.[I-] |
| InChI | InChI=1S/C18H19N3O2.HI/c1-10(2)13-5-7-14(8-6-13)21-12(4)9-11(3)15-16(21)19-18(23)20-17(15)22;/h5-10H,1-4H3,(H,20,22,23);1H |
| InChIKey | RMKSSTWBOXCVGW-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|