About N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide
N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide (PubChem CID 15945344) has the molecular formula C16H29IN2
and a molecular weight of 376.33 g/mol. Its IUPAC name is N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide.
Molecular Properties
| Compound Name | N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide |
| PubChem CID | 15945344 |
| Molecular Formula | C16H29IN2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide |
| SMILES | CCN(CC)C1=CC(=[N+]2CCCC2)CC(C)(C)C1.[I-] |
| InChI | InChI=1S/C16H29N2.HI/c1-5-17(6-2)14-11-15(13-16(3,4)12-14)18-9-7-8-10-18;/h11H,5-10,12-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IDGGHWOXZFDDHT-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
The IUPAC name of N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide (CID 15945344) is N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide.
What is the SMILES notation for N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
The canonical SMILES for N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide is CCN(CC)C1=CC(=[N+]2CCCC2)CC(C)(C)C1.[I-].
What is the InChIKey of N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
The InChIKey is IDGGHWOXZFDDHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H29N2.HI/c1-5-17(6-2)14-11-15(13-16(3,4)12-14)18-9-7-8-10-18;/h11H,5-10,12-13H2,1-4H3;1H/q+1;/p-1.
What are the key properties of N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide?
N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide has a molecular weight of 376.33 g/mol, XLogP of 0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide is sourced from PubChem (CID 15945344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).