C28H37ClO8 — CID 159454549
ethyl 4-chloro-4-oxobutanoate;ethyl 4-(2-methoxy-4-methylphenyl)-4-oxobutanoate;1-methoxy-3-methylbenzene (PubChem CID 159454549) has the molecular formula C28H37ClO8 and a molecular weight of 537.05 g/mol. Its IUPAC name is ethyl 4-chloro-4-oxobutanoate;ethyl 4-(2-methoxy-4-methylphenyl)-4-oxobutanoate;1-methoxy-3-methylbenzene.
| Compound Name | ethyl 4-chloro-4-oxobutanoate;ethyl 4-(2-methoxy-4-methylphenyl)-4-oxobutanoate;1-methoxy-3-methylbenzene |
|---|---|
| PubChem CID | 159454549 |
| Molecular Formula | C28H37ClO8 |
| Molecular Weight | 537.05 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | ethyl 4-chloro-4-oxobutanoate;ethyl 4-(2-methoxy-4-methylphenyl)-4-oxobutanoate;1-methoxy-3-methylbenzene |
| SMILES | CCOC(=O)CCC(=O)Cl.CCOC(=O)CCC(=O)c1ccc(C)cc1OC.COc1cccc(C)c1 |
| InChI | InChI=1S/C14H18O4.C8H10O.C6H9ClO3/c1-4-18-14(16)8-7-12(15)11-6-5-10(2)9-13(11)17-3;1-7-4-3-5-8(6-7)9-2;1-2-10-6(9)4-3-5(7)8/h5-6,9H,4,7-8H2,1-3H3;3-6H,1-2H3;2-4H2,1H3 |
| InChIKey | LTULXKSUMZWWRN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.05 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|