About propan-2-yl 4-pyridin-4-ylbutanoate
propan-2-yl 4-pyridin-4-ylbutanoate (PubChem CID 159454853) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is propan-2-yl 4-pyridin-4-ylbutanoate.
Molecular Properties
| Compound Name | propan-2-yl 4-pyridin-4-ylbutanoate |
| PubChem CID | 159454853 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | propan-2-yl 4-pyridin-4-ylbutanoate |
| SMILES | CC(C)OC(=O)CCCc1ccncc1 |
| InChI | InChI=1S/C12H17NO2/c1-10(2)15-12(14)5-3-4-11-6-8-13-9-7-11/h6-10H,3-5H2,1-2H3 |
| InChIKey | LTVKDQHOEPBSHD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 4-pyridin-4-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-pyridin-4-ylbutanoate?
The IUPAC name of propan-2-yl 4-pyridin-4-ylbutanoate (CID 159454853) is propan-2-yl 4-pyridin-4-ylbutanoate.
What is the SMILES notation for propan-2-yl 4-pyridin-4-ylbutanoate?
The canonical SMILES for propan-2-yl 4-pyridin-4-ylbutanoate is CC(C)OC(=O)CCCc1ccncc1.
What is the InChIKey of propan-2-yl 4-pyridin-4-ylbutanoate?
The InChIKey is LTVKDQHOEPBSHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-10(2)15-12(14)5-3-4-11-6-8-13-9-7-11/h6-10H,3-5H2,1-2H3.
What are the key properties of propan-2-yl 4-pyridin-4-ylbutanoate?
propan-2-yl 4-pyridin-4-ylbutanoate has a molecular weight of 207.27 g/mol, XLogP of 2.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-pyridin-4-ylbutanoate is sourced from PubChem (CID 159454853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).