About N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide
N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide (PubChem CID 15945502) has the molecular formula C21H25NO3S
and a molecular weight of 371.50 g/mol. Its IUPAC name is N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide |
| PubChem CID | 15945502 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide |
| SMILES | COc1ccc2c(c1)C(SCC(=O)NCc1ccccc1)CC(C)(C)O2 |
| InChI | InChI=1S/C21H25NO3S/c1-21(2)12-19(17-11-16(24-3)9-10-18(17)25-21)26-14-20(23)22-13-15-7-5-4-6-8-15/h4-11,19H,12-14H2,1-3H3,(H,22,23) |
| InChIKey | ZKWPYWALZUJALJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide?
The IUPAC name of N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide (CID 15945502) is N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide.
What is the SMILES notation for N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide?
The canonical SMILES for N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide is COc1ccc2c(c1)C(SCC(=O)NCc1ccccc1)CC(C)(C)O2.
What is the InChIKey of N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide?
The InChIKey is ZKWPYWALZUJALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3S/c1-21(2)12-19(17-11-16(24-3)9-10-18(17)25-21)26-14-20(23)22-13-15-7-5-4-6-8-15/h4-11,19H,12-14H2,1-3H3,(H,22,23).
What are the key properties of N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide?
N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide has a molecular weight of 371.50 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfanyl]acetamide is sourced from PubChem (CID 15945502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).