C12H25O7S+ — CID 159455186
(2S,3S,4R,5S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4,5-tetrol (PubChem CID 159455186) has the molecular formula C12H25O7S+ and a molecular weight of 313.39 g/mol. Its IUPAC name is (2S,3S,4R,5S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4R,5S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 159455186 |
| Molecular Formula | C12H25O7S+ |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2S,3S,4R,5S)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]heptane-2,3,4,5-tetrol |
| SMILES | CC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H25O7S/c1-2-6(14)11(18)12(19)8(16)5-20-4-7(15)10(17)9(20)3-13/h6-19H,2-5H2,1H3/q+1/t6-,7+,8+,9+,10-,11+,12+,20?/m0/s1 |
| InChIKey | HRSQKLLALYJUAA-CAFVBXMMSA-N |
| XLogP | -3.45 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|