About dibenzo-p-dioxin;phenoxathiine;thianthrene
dibenzo-p-dioxin;phenoxathiine;thianthrene (PubChem CID 159455407) has the molecular formula C36H24O3S3
and a molecular weight of 600.79 g/mol. Its IUPAC name is dibenzo-p-dioxin;phenoxathiine;thianthrene.
Molecular Properties
| Compound Name | dibenzo-p-dioxin;phenoxathiine;thianthrene |
| PubChem CID | 159455407 |
| Molecular Formula | C36H24O3S3 |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | dibenzo-p-dioxin;phenoxathiine;thianthrene |
| SMILES | c1ccc2c(c1)Oc1ccccc1O2.c1ccc2c(c1)Oc1ccccc1S2.c1ccc2c(c1)Sc1ccccc1S2 |
| InChI | InChI=1S/C12H8O2.C12H8OS.C12H8S2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h3*1-8H |
| InChIKey | LTXGKSSBWOJHLN-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dibenzo-p-dioxin;phenoxathiine;thianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzo-p-dioxin;phenoxathiine;thianthrene?
The IUPAC name of dibenzo-p-dioxin;phenoxathiine;thianthrene (CID 159455407) is dibenzo-p-dioxin;phenoxathiine;thianthrene.
What is the SMILES notation for dibenzo-p-dioxin;phenoxathiine;thianthrene?
The canonical SMILES for dibenzo-p-dioxin;phenoxathiine;thianthrene is c1ccc2c(c1)Oc1ccccc1O2.c1ccc2c(c1)Oc1ccccc1S2.c1ccc2c(c1)Sc1ccccc1S2.
What is the InChIKey of dibenzo-p-dioxin;phenoxathiine;thianthrene?
The InChIKey is LTXGKSSBWOJHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2.C12H8OS.C12H8S2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h3*1-8H.
What are the key properties of dibenzo-p-dioxin;phenoxathiine;thianthrene?
dibenzo-p-dioxin;phenoxathiine;thianthrene has a molecular weight of 600.79 g/mol, XLogP of 11.83, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzo-p-dioxin;phenoxathiine;thianthrene is sourced from PubChem (CID 159455407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).