About 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide
1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide (PubChem CID 15945565) has the molecular formula C22H21BrFN3
and a molecular weight of 426.33 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide |
| PubChem CID | 15945565 |
| Molecular Formula | C22H21BrFN3 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CCc2ccccc2)c2ccccc2n1Cc1ccccc1F |
| InChI | InChI=1S/C22H20FN3.BrH/c23-19-11-5-4-10-18(19)16-26-21-13-7-6-12-20(21)25(22(26)24)15-14-17-8-2-1-3-9-17;/h1-13,24H,14-16H2;1H/b24-22+; |
| InChIKey | MSBODPOHXRPGFL-HDPAMLMOSA-N |
| XLogP | 4.93 |
| TPSA | 33.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide?
The IUPAC name of 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide (CID 15945565) is 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide.
What is the SMILES notation for 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide?
The canonical SMILES for 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide is Br.[H]/N=c1\n(CCc2ccccc2)c2ccccc2n1Cc1ccccc1F.
What is the InChIKey of 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide?
The InChIKey is MSBODPOHXRPGFL-HDPAMLMOSA-N. The full InChI is InChI=1S/C22H20FN3.BrH/c23-19-11-5-4-10-18(19)16-26-21-13-7-6-12-20(21)25(22(26)24)15-14-17-8-2-1-3-9-17;/h1-13,24H,14-16H2;1H/b24-22+;.
What are the key properties of 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide?
1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide has a molecular weight of 426.33 g/mol, XLogP of 4.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-fluorophenyl)methyl]-3-(2-phenylethyl)benzimidazol-2-imine;hydrobromide is sourced from PubChem (CID 15945565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).