About N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride
N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride (PubChem CID 15945578) has the molecular formula C15H24ClN3O5
and a molecular weight of 361.83 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride |
| PubChem CID | 15945578 |
| Molecular Formula | C15H24ClN3O5 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride |
| SMILES | CCN1CCCC(NC(=O)c2cc([N+](=O)[O-])ccc2OC)C1.Cl.O |
| InChI | InChI=1S/C15H21N3O4.ClH.H2O/c1-3-17-8-4-5-11(10-17)16-15(19)13-9-12(18(20)21)6-7-14(13)22-2;;/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,16,19);1H;1H2 |
| InChIKey | UXLVBXNCRIWWDJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
The IUPAC name of N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride (CID 15945578) is N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride.
What is the SMILES notation for N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
The canonical SMILES for N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride is CCN1CCCC(NC(=O)c2cc([N+](=O)[O-])ccc2OC)C1.Cl.O.
What is the InChIKey of N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
The InChIKey is UXLVBXNCRIWWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O4.ClH.H2O/c1-3-17-8-4-5-11(10-17)16-15(19)13-9-12(18(20)21)6-7-14(13)22-2;;/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,16,19);1H;1H2.
What are the key properties of N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride?
N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride has a molecular weight of 361.83 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethylpiperidin-3-yl)-2-methoxy-5-nitrobenzamide;hydrate;hydrochloride is sourced from PubChem (CID 15945578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).