About 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane
1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane (PubChem CID 159456083) has the molecular formula C28H38O7
and a molecular weight of 486.61 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 159456083 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane |
| SMILES | OC1CCC2(CC1)OCCO2.Oc1ccccc1.c1ccc(OC2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C14H18O3.C8H14O3.C6H6O/c1-2-4-12(5-3-1)17-13-6-8-14(9-7-13)15-10-11-16-14;9-7-1-3-8(4-2-7)10-5-6-11-8;7-6-4-2-1-3-5-6/h1-5,13H,6-11H2;7,9H,1-6H2;1-5,7H |
| InChIKey | LTZIDTJCCQAVFR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane (CID 159456083) is 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane is OC1CCC2(CC1)OCCO2.Oc1ccccc1.c1ccc(OC2CCC3(CC2)OCCO3)cc1.
What is the InChIKey of 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane?
The InChIKey is LTZIDTJCCQAVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3.C8H14O3.C6H6O/c1-2-4-12(5-3-1)17-13-6-8-14(9-7-13)15-10-11-16-14;9-7-1-3-8(4-2-7)10-5-6-11-8;7-6-4-2-1-3-5-6/h1-5,13H,6-11H2;7,9H,1-6H2;1-5,7H.
What are the key properties of 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane?
1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane has a molecular weight of 486.61 g/mol, XLogP of 4.81, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.5]decan-8-ol;phenol;8-phenoxy-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 159456083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).