About 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride
6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride (PubChem CID 15945630) has the molecular formula C16H28ClNO
and a molecular weight of 285.86 g/mol. Its IUPAC name is 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride |
| PubChem CID | 15945630 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride |
| SMILES | CN(C)CCCC(C)(O)C(C)(C)c1ccccc1.Cl |
| InChI | InChI=1S/C16H27NO.ClH/c1-15(2,14-10-7-6-8-11-14)16(3,18)12-9-13-17(4)5;/h6-8,10-11,18H,9,12-13H2,1-5H3;1H |
| InChIKey | YKUOYWQKOWVDIO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride?
The IUPAC name of 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride (CID 15945630) is 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride.
What is the SMILES notation for 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride?
The canonical SMILES for 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride is CN(C)CCCC(C)(O)C(C)(C)c1ccccc1.Cl.
What is the InChIKey of 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride?
The InChIKey is YKUOYWQKOWVDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO.ClH/c1-15(2,14-10-7-6-8-11-14)16(3,18)12-9-13-17(4)5;/h6-8,10-11,18H,9,12-13H2,1-5H3;1H.
What are the key properties of 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride?
6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride has a molecular weight of 285.86 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol;hydrochloride is sourced from PubChem (CID 15945630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).