About (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate
(4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate (PubChem CID 15945640) has the molecular formula C19H16N2O7
and a molecular weight of 384.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate |
| PubChem CID | 15945640 |
| Molecular Formula | C19H16N2O7 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate |
| SMILES | CC(O)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N2O7/c1-11(22)16(20-17(23)14-4-2-3-5-15(14)18(20)24)19(25)28-10-12-6-8-13(9-7-12)21(26)27/h2-9,11,16,22H,10H2,1H3 |
| InChIKey | NUKYLILLNPLJJG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate?
The IUPAC name of (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate (CID 15945640) is (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate.
What is the SMILES notation for (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate?
The canonical SMILES for (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate is CC(O)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate?
The InChIKey is NUKYLILLNPLJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O7/c1-11(22)16(20-17(23)14-4-2-3-5-15(14)18(20)24)19(25)28-10-12-6-8-13(9-7-12)21(26)27/h2-9,11,16,22H,10H2,1H3.
What are the key properties of (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate?
(4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate has a molecular weight of 384.34 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)-3-hydroxybutanoate is sourced from PubChem (CID 15945640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).