About 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide
2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide (PubChem CID 15945655) has the molecular formula C17H17BrN2OS
and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide |
| PubChem CID | 15945655 |
| Molecular Formula | C17H17BrN2OS |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide |
| SMILES | Br.OCCn1c(-c2ccccc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C17H16N2OS.BrH/c20-12-11-19-16(14-7-3-1-4-8-14)13-21-17(19)18-15-9-5-2-6-10-15;/h1-10,13,20H,11-12H2;1H/b18-17-; |
| InChIKey | DFLLMOWGDFHJSQ-YBFBCAGJSA-N |
| XLogP | 4.02 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide?
The IUPAC name of 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide (CID 15945655) is 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide.
What is the SMILES notation for 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide?
The canonical SMILES for 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide is Br.OCCn1c(-c2ccccc2)cs/c1=N\c1ccccc1.
What is the InChIKey of 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide?
The InChIKey is DFLLMOWGDFHJSQ-YBFBCAGJSA-N. The full InChI is InChI=1S/C17H16N2OS.BrH/c20-12-11-19-16(14-7-3-1-4-8-14)13-21-17(19)18-15-9-5-2-6-10-15;/h1-10,13,20H,11-12H2;1H/b18-17-;.
What are the key properties of 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide?
2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide has a molecular weight of 377.31 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenyl-2-phenylimino-1,3-thiazol-3-yl)ethanol;hydrobromide is sourced from PubChem (CID 15945655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).