About 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid
1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid (PubChem CID 15945680) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid |
| PubChem CID | 15945680 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid |
| SMILES | CN(C)Cc1ccccc1Cc1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H19N.C4H4O4/c1-17(2)13-16-11-7-6-10-15(16)12-14-8-4-3-5-9-14;5-3(6)1-2-4(7)8/h3-11H,12-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MRPWVTQZQQVFIV-BTJKTKAUSA-N |
| XLogP | 3.05 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid?
The IUPAC name of 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid (CID 15945680) is 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid.
What is the SMILES notation for 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid?
The canonical SMILES for 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid is CN(C)Cc1ccccc1Cc1ccccc1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid?
The InChIKey is MRPWVTQZQQVFIV-BTJKTKAUSA-N. The full InChI is InChI=1S/C16H19N.C4H4O4/c1-17(2)13-16-11-7-6-10-15(16)12-14-8-4-3-5-9-14;5-3(6)1-2-4(7)8/h3-11H,12-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid?
1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid has a molecular weight of 341.41 g/mol, XLogP of 3.05, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-benzylphenyl)-N,N-dimethylmethanamine;(Z)-but-2-enedioic acid is sourced from PubChem (CID 15945680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).