C15H18N6O3S2 — CID 15945695
ethyl 2-[[5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate (PubChem CID 15945695) has the molecular formula C15H18N6O3S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is ethyl 2-[[5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate.
| Compound Name | ethyl 2-[[5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 15945695 |
| Molecular Formula | C15H18N6O3S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 2-[[5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate |
| SMILES | CCOC(=O)C(C)Sc1nnc(CSc2nc3nc(C)cc(C)n3n2)o1 |
| InChI | InChI=1S/C15H18N6O3S2/c1-5-23-12(22)10(4)26-15-19-18-11(24-15)7-25-14-17-13-16-8(2)6-9(3)21(13)20-14/h6,10H,5,7H2,1-4H3 |
| InChIKey | PCYAQJGEPSZALF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |