C23H28ClN3O5 — CID 15945740
2-[2-[(2,4,6-trimethylphenyl)carbamoyl]pyrrolidin-1-yl]ethyl 3-nitrobenzoate;hydrochloride (PubChem CID 15945740) has the molecular formula C23H28ClN3O5 and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-[2-[(2,4,6-trimethylphenyl)carbamoyl]pyrrolidin-1-yl]ethyl 3-nitrobenzoate;hydrochloride.
| Compound Name | 2-[2-[(2,4,6-trimethylphenyl)carbamoyl]pyrrolidin-1-yl]ethyl 3-nitrobenzoate;hydrochloride |
|---|---|
| PubChem CID | 15945740 |
| Molecular Formula | C23H28ClN3O5 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[2-[(2,4,6-trimethylphenyl)carbamoyl]pyrrolidin-1-yl]ethyl 3-nitrobenzoate;hydrochloride |
| SMILES | Cc1cc(C)c(NC(=O)C2CCCN2CCOC(=O)c2cccc([N+](=O)[O-])c2)c(C)c1.Cl |
| InChI | InChI=1S/C23H27N3O5.ClH/c1-15-12-16(2)21(17(3)13-15)24-22(27)20-8-5-9-25(20)10-11-31-23(28)18-6-4-7-19(14-18)26(29)30;/h4,6-7,12-14,20H,5,8-11H2,1-3H3,(H,24,27);1H |
| InChIKey | FHVGRUGHZQLZTK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|