C20H32ClN5O3 — CID 15945748
2-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrate;hydrochloride (PubChem CID 15945748) has the molecular formula C20H32ClN5O3 and a molecular weight of 425.96 g/mol. Its IUPAC name is 2-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrate;hydrochloride.
| Compound Name | 2-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrate;hydrochloride |
|---|---|
| PubChem CID | 15945748 |
| Molecular Formula | C20H32ClN5O3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[4-[4-(4-aminophenyl)piperazin-1-yl]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrate;hydrochloride |
| SMILES | Cl.Nc1ccc(N2CCN(CCCCN3C(=O)C4CCCN4C3=O)CC2)cc1.O |
| InChI | InChI=1S/C20H29N5O2.ClH.H2O/c21-16-5-7-17(8-6-16)23-14-12-22(13-15-23)9-1-2-10-25-19(26)18-4-3-11-24(18)20(25)27;;/h5-8,18H,1-4,9-15,21H2;1H;1H2 |
| InChIKey | QWPTUXYDCKCCOH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|