C15H28N2O8 — CID 159457664
4-[(1R,2S,3S,4S,5R,6R)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]butanoic acid (PubChem CID 159457664) has the molecular formula C15H28N2O8 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[(1R,2S,3S,4S,5R,6R)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]butanoic acid.
| Compound Name | 4-[(1R,2S,3S,4S,5R,6R)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 159457664 |
| Molecular Formula | C15H28N2O8 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[(1R,2S,3S,4S,5R,6R)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]butanoic acid |
| SMILES | O=C(O)CCC[C@H]1[C@@H](O)[C@@H](NCCO)[C@@H](O)[C@@H](NCCC(=O)O)[C@H]1O |
| InChI | InChI=1S/C15H28N2O8/c18-7-6-17-12-14(24)8(2-1-3-9(19)20)13(23)11(15(12)25)16-5-4-10(21)22/h8,11-18,23-25H,1-7H2,(H,19,20)(H,21,22)/t8-,11+,12-,13+,14-,15+/m1/s1 |
| InChIKey | DZNFXWSXKFDZMP-KFBSQEHXSA-N |
| XLogP | -2.66 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |