About 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate
2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate (PubChem CID 15945780) has the molecular formula C18H18ClNO5
and a molecular weight of 363.80 g/mol. Its IUPAC name is 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate.
Molecular Properties
| Compound Name | 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate |
| PubChem CID | 15945780 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)[n+](C)o2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H18NO.ClHO4/c1-13-4-8-15(9-5-13)17-12-18(20-19(17)3)16-10-6-14(2)7-11-16;2-1(3,4)5/h4-12H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | FBESDADCNRFVAC-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate?
The IUPAC name of 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate (CID 15945780) is 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate.
What is the SMILES notation for 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate?
The canonical SMILES for 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate is Cc1ccc(-c2cc(-c3ccc(C)cc3)[n+](C)o2)cc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate?
The InChIKey is FBESDADCNRFVAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H18NO.ClHO4/c1-13-4-8-15(9-5-13)17-12-18(20-19(17)3)16-10-6-14(2)7-11-16;2-1(3,4)5/h4-12H,1-3H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate?
2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate has a molecular weight of 363.80 g/mol, XLogP of -0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,5-bis(4-methylphenyl)-1,2-oxazol-2-ium perchlorate is sourced from PubChem (CID 15945780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).