About 2-aminoethyl N-piperazin-1-ylcarbamate
2-aminoethyl N-piperazin-1-ylcarbamate (PubChem CID 159457935) has the molecular formula C7H16N4O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-aminoethyl N-piperazin-1-ylcarbamate.
Molecular Properties
| Compound Name | 2-aminoethyl N-piperazin-1-ylcarbamate |
| PubChem CID | 159457935 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-aminoethyl N-piperazin-1-ylcarbamate |
| SMILES | NCCOC(=O)NN1CCNCC1 |
| InChI | InChI=1S/C7H16N4O2/c8-1-6-13-7(12)10-11-4-2-9-3-5-11/h9H,1-6,8H2,(H,10,12) |
| InChIKey | LUFJQWIJBJLMOX-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminoethyl N-piperazin-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl N-piperazin-1-ylcarbamate?
The IUPAC name of 2-aminoethyl N-piperazin-1-ylcarbamate (CID 159457935) is 2-aminoethyl N-piperazin-1-ylcarbamate.
What is the SMILES notation for 2-aminoethyl N-piperazin-1-ylcarbamate?
The canonical SMILES for 2-aminoethyl N-piperazin-1-ylcarbamate is NCCOC(=O)NN1CCNCC1.
What is the InChIKey of 2-aminoethyl N-piperazin-1-ylcarbamate?
The InChIKey is LUFJQWIJBJLMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O2/c8-1-6-13-7(12)10-11-4-2-9-3-5-11/h9H,1-6,8H2,(H,10,12).
What are the key properties of 2-aminoethyl N-piperazin-1-ylcarbamate?
2-aminoethyl N-piperazin-1-ylcarbamate has a molecular weight of 188.23 g/mol, XLogP of -1.51, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl N-piperazin-1-ylcarbamate is sourced from PubChem (CID 159457935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).