About 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride
1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride (PubChem CID 15945806) has the molecular formula C21H26ClNO3S
and a molecular weight of 407.96 g/mol. Its IUPAC name is 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride |
| PubChem CID | 15945806 |
| Molecular Formula | C21H26ClNO3S |
| Molecular Weight | 407.96 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride |
| SMILES | Cl.O.O=C1Cc2ccccc2Sc2c(OCCN3CCCCC3)cccc21 |
| InChI | InChI=1S/C21H23NO2S.ClH.H2O/c23-18-15-16-7-2-3-10-20(16)25-21-17(18)8-6-9-19(21)24-14-13-22-11-4-1-5-12-22;;/h2-3,6-10H,1,4-5,11-15H2;1H;1H2 |
| InChIKey | ONCIRUIJTRGEAF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride?
The IUPAC name of 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride (CID 15945806) is 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride.
What is the SMILES notation for 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride?
The canonical SMILES for 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride is Cl.O.O=C1Cc2ccccc2Sc2c(OCCN3CCCCC3)cccc21.
What is the InChIKey of 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride?
The InChIKey is ONCIRUIJTRGEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO2S.ClH.H2O/c23-18-15-16-7-2-3-10-20(16)25-21-17(18)8-6-9-19(21)24-14-13-22-11-4-1-5-12-22;;/h2-3,6-10H,1,4-5,11-15H2;1H;1H2.
What are the key properties of 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride?
1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride has a molecular weight of 407.96 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-piperidin-1-ylethoxy)-6H-benzo[b][1]benzothiepin-5-one;hydrate;hydrochloride is sourced from PubChem (CID 15945806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).