C31H50O6Si — CID 159458320
(1R,7S,9E,17R)-11-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 159458320) has the molecular formula C31H50O6Si and a molecular weight of 546.82 g/mol. Its IUPAC name is (1R,7S,9E,17R)-11-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,7S,9E,17R)-11-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 159458320 |
| Molecular Formula | C31H50O6Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | (1R,7S,9E,17R)-11-[tert-butyl(dimethyl)silyl]oxy-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CCC[C@@H]2CC=C[C@@H](CC=CC(=O)O[C@H]([C@H]3COC(C)(C)O3)C/C=C/C(O[Si](C)(C)C(C)(C)C)C1)O2 |
| InChI | InChI=1S/C31H50O6Si/c1-23-13-9-14-24-15-10-16-25(34-24)17-12-20-29(32)35-27(28-22-33-31(5,6)36-28)19-11-18-26(21-23)37-38(7,8)30(2,3)4/h10-12,16,18,20,24-28H,1,9,13-15,17,19,21-22H2,2-8H3/b18-11+,20-12?/t24-,25+,26?,27+,28-/m1/s1 |
| InChIKey | ORILLOXEGKACLZ-HDKDNENBSA-N |
| XLogP | 7.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|