C23H28N6O5 — CID 159458721
N-ethylbutan-1-amine;4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylcarbamoyl]-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid (PubChem CID 159458721) has the molecular formula C23H28N6O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-ethylbutan-1-amine;4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylcarbamoyl]-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid.
| Compound Name | N-ethylbutan-1-amine;4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylcarbamoyl]-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid |
|---|---|
| PubChem CID | 159458721 |
| Molecular Formula | C23H28N6O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-ethylbutan-1-amine;4-[(3-oxo-4H-1,4-benzoxazin-6-yl)methylcarbamoyl]-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid |
| SMILES | CCCCNCC.O=C1COc2ccc(CNC(=O)c3ncnc4c(C(=O)O)c[nH]c34)cc2N1 |
| InChI | InChI=1S/C17H13N5O5.C6H15N/c23-12-6-27-11-2-1-8(3-10(11)22-12)4-19-16(24)15-14-13(20-7-21-15)9(5-18-14)17(25)26;1-3-5-6-7-4-2/h1-3,5,7,18H,4,6H2,(H,19,24)(H,22,23)(H,25,26);7H,3-6H2,1-2H3 |
| InChIKey | LUHVAJONCOFLPY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|