C14H21NO3 — CID 15945971
(2R,3R,4R)-2-(hydroxymethyl)-1-(2-phenylethyl)piperidine-3,4-diol (PubChem CID 15945971) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2R,3R,4R)-2-(hydroxymethyl)-1-(2-phenylethyl)piperidine-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(hydroxymethyl)-1-(2-phenylethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 15945971 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2R,3R,4R)-2-(hydroxymethyl)-1-(2-phenylethyl)piperidine-3,4-diol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c16-10-12-14(18)13(17)7-9-15(12)8-6-11-4-2-1-3-5-11/h1-5,12-14,16-18H,6-10H2/t12-,13-,14-/m1/s1 |
| InChIKey | QLWIXCJYZNKSAT-MGPQQGTHSA-N |
| XLogP | 0.02 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |