C25H33FN2O5 — CID 159460903
(E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxypent-3-en-2-one (PubChem CID 159460903) has the molecular formula C25H33FN2O5 and a molecular weight of 460.55 g/mol. Its IUPAC name is (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxypent-3-en-2-one.
| Compound Name | (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 159460903 |
| Molecular Formula | C25H33FN2O5 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (E)-3-[(1S,2S,4S,5S,10S)-5-ethyl-14-fluoro-12-methoxy-18,21-dioxa-7,17-diazapentacyclo[8.7.4.01,10.02,7.011,16]henicosa-11(16),12,14-trien-4-yl]-1-hydroxypent-3-en-2-one |
| SMILES | C/C=C(/C(=O)CO)[C@H]1C[C@@H]2N(CC[C@@]34OCCO[C@@]23Nc2cc(F)cc(OC)c24)C[C@H]1CC |
| InChI | InChI=1S/C25H33FN2O5/c1-4-15-13-28-7-6-24-23-19(10-16(26)11-21(23)31-3)27-25(24,33-9-8-32-24)22(28)12-18(15)17(5-2)20(30)14-29/h5,10-11,15,18,22,27,29H,4,6-9,12-14H2,1-3H3/b17-5+/t15-,18+,22+,24+,25+/m1/s1 |
| InChIKey | CAYGKTDZGCKYDI-CFQXPVGRSA-N |
| XLogP | 2.83 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|