C26H22F2N4O6 — CID 159461308
7-[3-(2,4-difluorophenyl)propanoyl]-3-(furan-2-ylmethyl)-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 159461308) has the molecular formula C26H22F2N4O6 and a molecular weight of 524.48 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)propanoyl]-3-(furan-2-ylmethyl)-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[3-(2,4-difluorophenyl)propanoyl]-3-(furan-2-ylmethyl)-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 159461308 |
| Molecular Formula | C26H22F2N4O6 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)propanoyl]-3-(furan-2-ylmethyl)-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | Cc1cc(CN2CN(Cc3ccco3)C(=O)c3c(O)c(=O)c(C(=O)CCc4ccc(F)cc4F)cn32)no1 |
| InChI | InChI=1S/C26H22F2N4O6/c1-15-9-18(29-38-15)11-31-14-30(12-19-3-2-8-37-19)26(36)23-25(35)24(34)20(13-32(23)31)22(33)7-5-16-4-6-17(27)10-21(16)28/h2-4,6,8-10,13,35H,5,7,11-12,14H2,1H3 |
| InChIKey | UEGRVXONUOJHLN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |