C16H10F2N4O4 — CID 159461516
N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxy-3-isocyanobenzamide (PubChem CID 159461516) has the molecular formula C16H10F2N4O4 and a molecular weight of 360.28 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxy-3-isocyanobenzamide.
| Compound Name | N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxy-3-isocyanobenzamide |
|---|---|
| PubChem CID | 159461516 |
| Molecular Formula | C16H10F2N4O4 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-(diaminomethylidene)-2-(2,2-difluoro-1,3-benzodioxol-4-yl)-6-hydroxy-3-isocyanobenzamide |
| SMILES | [C-]#[N+]c1ccc(O)c(C(=O)N=C(N)N)c1-c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C16H10F2N4O4/c1-21-8-5-6-9(23)12(14(24)22-15(19)20)11(8)7-3-2-4-10-13(7)26-16(17,18)25-10/h2-6,23H,(H4,19,20,22,24) |
| InChIKey | LUQNKIFTDXXQIS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|