C17H21Cl — CID 159461596
(3aR,9bS)-6-chloro-7-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene (PubChem CID 159461596) has the molecular formula C17H21Cl and a molecular weight of 260.81 g/mol. Its IUPAC name is (3aR,9bS)-6-chloro-7-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene.
| Compound Name | (3aR,9bS)-6-chloro-7-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 159461596 |
| Molecular Formula | C17H21Cl |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3aR,9bS)-6-chloro-7-cyclopropyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene |
| SMILES | C[C@]12CCC[C@@H]1c1ccc(C3CC3)c(Cl)c1CC2 |
| InChI | InChI=1S/C17H21Cl/c1-17-9-2-3-15(17)13-7-6-12(11-4-5-11)16(18)14(13)8-10-17/h6-7,11,15H,2-5,8-10H2,1H3/t15-,17-/m1/s1 |
| InChIKey | LUQUMGNMMYMBHQ-NVXWUHKLSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |