About methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide
methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide (PubChem CID 159463313) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide.
Molecular Properties
| Compound Name | methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide |
| PubChem CID | 159463313 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide |
| SMILES | C.CCC(=O)CC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C9H13NO4.CH4/c1-2-6(11)5-8(12)10-7-3-4-14-9(7)13;/h7H,2-5H2,1H3,(H,10,12);1H4 |
| InChIKey | LUVZVPJKHMVSDJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide?
The IUPAC name of methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide (CID 159463313) is methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide.
What is the SMILES notation for methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide?
The canonical SMILES for methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide is C.CCC(=O)CC(=O)NC1CCOC1=O.
What is the InChIKey of methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide?
The InChIKey is LUVZVPJKHMVSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4.CH4/c1-2-6(11)5-8(12)10-7-3-4-14-9(7)13;/h7H,2-5H2,1H3,(H,10,12);1H4.
What are the key properties of methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide?
methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide has a molecular weight of 215.25 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-oxo-N-(2-oxooxolan-3-yl)pentanamide is sourced from PubChem (CID 159463313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).