C36H61ClNO5Si- — CID 159463587
methyl 7-[(1R,2R,3R)-3-[tert-butyl-[4-[ethyl(methyl)amino]phenyl]-methylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate chloride (PubChem CID 159463587) has the molecular formula C36H61ClNO5Si- and a molecular weight of 651.42 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl-[4-[ethyl(methyl)amino]phenyl]-methylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate chloride.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl-[4-[ethyl(methyl)amino]phenyl]-methylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate chloride |
|---|---|
| PubChem CID | 159463587 |
| Molecular Formula | C36H61ClNO5Si- |
| Molecular Weight | 651.42 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl-[4-[ethyl(methyl)amino]phenyl]-methylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate chloride |
| SMILES | CCCCC(C)(O)C/C=C/[C@H]1[C@H](O[Si](C)(c2ccc(N(C)CC)cc2)C(C)(C)C)CC(=O)[C@@H]1CCCCCCC(=O)OC.[Cl-] |
| InChI | InChI=1S/C36H61NO5Si.ClH/c1-10-12-25-36(6,40)26-17-19-31-30(18-15-13-14-16-20-34(39)41-8)32(38)27-33(31)42-43(9,35(3,4)5)29-23-21-28(22-24-29)37(7)11-2;/h17,19,21-24,30-31,33,40H,10-16,18,20,25-27H2,1-9H3;1H/p-1/b19-17+;/t30-,31-,33-,36?,43?;/m1./s1 |
| InChIKey | IQMLVKJGMVGUJJ-ODDIJLNSSA-M |
| XLogP | 4.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|