C25H30N2O3S — CID 159465927
N,N-dimethyl-4-[4-(4,4,6-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)buta-1,3-dienyl]aniline;sulfur dioxide (PubChem CID 159465927) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(4,4,6-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)buta-1,3-dienyl]aniline;sulfur dioxide.
| Compound Name | N,N-dimethyl-4-[4-(4,4,6-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)buta-1,3-dienyl]aniline;sulfur dioxide |
|---|---|
| PubChem CID | 159465927 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N,N-dimethyl-4-[4-(4,4,6-trimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)buta-1,3-dienyl]aniline;sulfur dioxide |
| SMILES | Cc1ccc2c(c1)C(C)(C)C1(C=CC=Cc3ccc(N(C)C)cc3)OCCN21.O=S=O |
| InChI | InChI=1S/C25H30N2O.O2S/c1-19-9-14-23-22(18-19)24(2,3)25(27(23)16-17-28-25)15-7-6-8-20-10-12-21(13-11-20)26(4)5;1-3-2/h6-15,18H,16-17H2,1-5H3; |
| InChIKey | LVEGUGPTGXUKLC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|