C18H32N2O4 — CID 15946639
N-(2-pyrrolidin-1-ylethyl)-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine (PubChem CID 15946639) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine |
|---|---|
| PubChem CID | 15946639 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-amine |
| SMILES | C1CCC2(CC1)OOC1(CCC(NCCN3CCCC3)CC1)OO2 |
| InChI | InChI=1S/C18H32N2O4/c1-2-8-17(9-3-1)21-23-18(24-22-17)10-6-16(7-11-18)19-12-15-20-13-4-5-14-20/h16,19H,1-15H2 |
| InChIKey | UJOQTGSKVYRFII-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|