About 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid
5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid (PubChem CID 159466593) has the molecular formula C14H19N7O4
and a molecular weight of 349.35 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid |
| PubChem CID | 159466593 |
| Molecular Formula | C14H19N7O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid |
| SMILES | CC(C)(O)CNC(=O)c1ncncc1N.Nc1cncnc1C(=O)O |
| InChI | InChI=1S/C9H14N4O2.C5H5N3O2/c1-9(2,15)4-12-8(14)7-6(10)3-11-5-13-7;6-3-1-7-2-8-4(3)5(9)10/h3,5,15H,4,10H2,1-2H3,(H,12,14);1-2H,6H2,(H,9,10) |
| InChIKey | LVGLRDWSYMSEED-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 190.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid?
The IUPAC name of 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid (CID 159466593) is 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid.
What is the SMILES notation for 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid?
The canonical SMILES for 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid is CC(C)(O)CNC(=O)c1ncncc1N.Nc1cncnc1C(=O)O.
What is the InChIKey of 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid?
The InChIKey is LVGLRDWSYMSEED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2.C5H5N3O2/c1-9(2,15)4-12-8(14)7-6(10)3-11-5-13-7;6-3-1-7-2-8-4(3)5(9)10/h3,5,15H,4,10H2,1-2H3,(H,12,14);1-2H,6H2,(H,9,10).
What are the key properties of 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid?
5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid has a molecular weight of 349.35 g/mol, XLogP of -0.68, 4 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(2-hydroxy-2-methylpropyl)pyrimidine-4-carboxamide;5-aminopyrimidine-4-carboxylic acid is sourced from PubChem (CID 159466593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).