About propan-2-ol;(4-propoxyphenyl)boronic acid
propan-2-ol;(4-propoxyphenyl)boronic acid (PubChem CID 159466801) has the molecular formula C12H21BO4
and a molecular weight of 240.11 g/mol. Its IUPAC name is propan-2-ol;(4-propoxyphenyl)boronic acid.
Molecular Properties
| Compound Name | propan-2-ol;(4-propoxyphenyl)boronic acid |
| PubChem CID | 159466801 |
| Molecular Formula | C12H21BO4 |
| Molecular Weight | 240.11 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | propan-2-ol;(4-propoxyphenyl)boronic acid |
| SMILES | CC(C)O.CCCOc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C9H13BO3.C3H8O/c1-2-7-13-9-5-3-8(4-6-9)10(11)12;1-3(2)4/h3-6,11-12H,2,7H2,1H3;3-4H,1-2H3 |
| InChIKey | LVHCVXPOXIJQIL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ol;(4-propoxyphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;(4-propoxyphenyl)boronic acid?
The IUPAC name of propan-2-ol;(4-propoxyphenyl)boronic acid (CID 159466801) is propan-2-ol;(4-propoxyphenyl)boronic acid.
What is the SMILES notation for propan-2-ol;(4-propoxyphenyl)boronic acid?
The canonical SMILES for propan-2-ol;(4-propoxyphenyl)boronic acid is CC(C)O.CCCOc1ccc(B(O)O)cc1.
What is the InChIKey of propan-2-ol;(4-propoxyphenyl)boronic acid?
The InChIKey is LVHCVXPOXIJQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BO3.C3H8O/c1-2-7-13-9-5-3-8(4-6-9)10(11)12;1-3(2)4/h3-6,11-12H,2,7H2,1H3;3-4H,1-2H3.
What are the key properties of propan-2-ol;(4-propoxyphenyl)boronic acid?
propan-2-ol;(4-propoxyphenyl)boronic acid has a molecular weight of 240.11 g/mol, XLogP of 0.54, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;(4-propoxyphenyl)boronic acid is sourced from PubChem (CID 159466801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).