About sodium;benzene;iodate
sodium;benzene;iodate (PubChem CID 159467735) has the molecular formula C6H6INaO3
and a molecular weight of 276.00 g/mol. Its IUPAC name is sodium;benzene;iodate.
Molecular Properties
| Compound Name | sodium;benzene;iodate |
| PubChem CID | 159467735 |
| Molecular Formula | C6H6INaO3 |
| Molecular Weight | 276.00 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | sodium;benzene;iodate |
| SMILES | [Na+].[O-][I+2]([O-])[O-].c1ccccc1 |
| InChI | InChI=1S/C6H6.IO3.Na/c1-2-4-6-5-3-1;2-1(3)4;/h1-6H;;/q;-1;+1 |
| InChIKey | ZMLDJVMAQQNWSS-UHFFFAOYSA-N |
| XLogP | -7.87 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.00 |
| LogP ≤ 5 | -7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzene;iodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzene;iodate?
The IUPAC name of sodium;benzene;iodate (CID 159467735) is sodium;benzene;iodate.
What is the SMILES notation for sodium;benzene;iodate?
The canonical SMILES for sodium;benzene;iodate is [Na+].[O-][I+2]([O-])[O-].c1ccccc1.
What is the InChIKey of sodium;benzene;iodate?
The InChIKey is ZMLDJVMAQQNWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.IO3.Na/c1-2-4-6-5-3-1;2-1(3)4;/h1-6H;;/q;-1;+1.
What are the key properties of sodium;benzene;iodate?
sodium;benzene;iodate has a molecular weight of 276.00 g/mol, XLogP of -7.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzene;iodate is sourced from PubChem (CID 159467735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).