About 5-phenylthian-3-amine;5-phenylthian-3-one
5-phenylthian-3-amine;5-phenylthian-3-one (PubChem CID 159469856) has the molecular formula C22H27NOS2
and a molecular weight of 385.60 g/mol. Its IUPAC name is 5-phenylthian-3-amine;5-phenylthian-3-one.
Molecular Properties
| Compound Name | 5-phenylthian-3-amine;5-phenylthian-3-one |
| PubChem CID | 159469856 |
| Molecular Formula | C22H27NOS2 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 5-phenylthian-3-amine;5-phenylthian-3-one |
| SMILES | NC1CSCC(c2ccccc2)C1.O=C1CSCC(c2ccccc2)C1 |
| InChI | InChI=1S/C11H15NS.C11H12OS/c2*12-11-6-10(7-13-8-11)9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2;1-5,10H,6-8H2 |
| InChIKey | LVQYCJJNISFEDQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenylthian-3-amine;5-phenylthian-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylthian-3-amine;5-phenylthian-3-one?
The IUPAC name of 5-phenylthian-3-amine;5-phenylthian-3-one (CID 159469856) is 5-phenylthian-3-amine;5-phenylthian-3-one.
What is the SMILES notation for 5-phenylthian-3-amine;5-phenylthian-3-one?
The canonical SMILES for 5-phenylthian-3-amine;5-phenylthian-3-one is NC1CSCC(c2ccccc2)C1.O=C1CSCC(c2ccccc2)C1.
What is the InChIKey of 5-phenylthian-3-amine;5-phenylthian-3-one?
The InChIKey is LVQYCJJNISFEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS.C11H12OS/c2*12-11-6-10(7-13-8-11)9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2;1-5,10H,6-8H2.
What are the key properties of 5-phenylthian-3-amine;5-phenylthian-3-one?
5-phenylthian-3-amine;5-phenylthian-3-one has a molecular weight of 385.60 g/mol, XLogP of 4.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylthian-3-amine;5-phenylthian-3-one is sourced from PubChem (CID 159469856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).