C16H26Br2O3S2 — CID 159470028
2,3-dibromo-5-[5-(2,2-dimethylpropoxy)-2,2-dimethylpentyl]sulfonylthiophene (PubChem CID 159470028) has the molecular formula C16H26Br2O3S2 and a molecular weight of 490.32 g/mol. Its IUPAC name is 2,3-dibromo-5-[5-(2,2-dimethylpropoxy)-2,2-dimethylpentyl]sulfonylthiophene.
| Compound Name | 2,3-dibromo-5-[5-(2,2-dimethylpropoxy)-2,2-dimethylpentyl]sulfonylthiophene |
|---|---|
| PubChem CID | 159470028 |
| Molecular Formula | C16H26Br2O3S2 |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 2,3-dibromo-5-[5-(2,2-dimethylpropoxy)-2,2-dimethylpentyl]sulfonylthiophene |
| SMILES | CC(C)(C)COCCCC(C)(C)CS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C16H26Br2O3S2/c1-15(2,3)10-21-8-6-7-16(4,5)11-23(19,20)13-9-12(17)14(18)22-13/h9H,6-8,10-11H2,1-5H3 |
| InChIKey | NPLDSXHNVKTZNQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|